C38H48O5Si2 — CID 11308206
(2R,3S,4S,5R)-2,5-bis[[tert-butyl(diphenyl)silyl]oxymethyl]oxolane-3,4-diol (PubChem CID 11308206) has the molecular formula C38H48O5Si2 and a molecular weight of 640.97 g/mol. Its IUPAC name is (2R,3S,4S,5R)-2,5-bis[[tert-butyl(diphenyl)silyl]oxymethyl]oxolane-3,4-diol.
| Compound Name | (2R,3S,4S,5R)-2,5-bis[[tert-butyl(diphenyl)silyl]oxymethyl]oxolane-3,4-diol |
|---|---|
| PubChem CID | 11308206 |
| Molecular Formula | C38H48O5Si2 |
| Molecular Weight | 640.97 g/mol |
| Exact Mass | 640.30 |
| IUPAC Name | (2R,3S,4S,5R)-2,5-bis[[tert-butyl(diphenyl)silyl]oxymethyl]oxolane-3,4-diol |
| SMILES | CC(C)(C)[Si](OC[C@H]1O[C@H](CO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)[C@@H](O)[C@@H]1O)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C38H48O5Si2/c1-37(2,3)44(29-19-11-7-12-20-29,30-21-13-8-14-22-30)41-27-33-35(39)36(40)34(43-33)28-42-45(38(4,5)6,31-23-15-9-16-24-31)32-25-17-10-18-26-32/h7-26,33-36,39-40H,27-28H2,1-6H3/t33-,34-,35-,36-/m1/s1 |
| InChIKey | RFQVUTZSQKTQOE-MGXDLYCJSA-N |
| XLogP | 4.63 |
| TPSA | 68.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 640.97 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|