C39H40O4SSi2 — CID 11308332
(6aS,7S,9S,10S,10aR)-10-methoxy-9-methyl-2,2,5,5-tetraphenyl-7-phenylsulfanyl-4,6a,7,9,10,10a-hexahydro-3H-pyrano[3,4-g][1,6,2,5]dioxadisilocine (PubChem CID 11308332) has the molecular formula C39H40O4SSi2 and a molecular weight of 660.98 g/mol. Its IUPAC name is (6aS,7S,9S,10S,10aR)-10-methoxy-9-methyl-2,2,5,5-tetraphenyl-7-phenylsulfanyl-4,6a,7,9,10,10a-hexahydro-3H-pyrano[3,4-g][1,6,2,5]dioxadisilocine.
| Compound Name | (6aS,7S,9S,10S,10aR)-10-methoxy-9-methyl-2,2,5,5-tetraphenyl-7-phenylsulfanyl-4,6a,7,9,10,10a-hexahydro-3H-pyrano[3,4-g][1,6,2,5]dioxadisilocine |
|---|---|
| PubChem CID | 11308332 |
| Molecular Formula | C39H40O4SSi2 |
| Molecular Weight | 660.98 g/mol |
| Exact Mass | 660.22 |
| IUPAC Name | (6aS,7S,9S,10S,10aR)-10-methoxy-9-methyl-2,2,5,5-tetraphenyl-7-phenylsulfanyl-4,6a,7,9,10,10a-hexahydro-3H-pyrano[3,4-g][1,6,2,5]dioxadisilocine |
| SMILES | CO[C@@H]1[C@H]2O[Si](c3ccccc3)(c3ccccc3)CC[Si](c3ccccc3)(c3ccccc3)O[C@@H]2[C@H](Sc2ccccc2)O[C@H]1C |
| InChI | InChI=1S/C39H40O4SSi2/c1-30-36(40-2)37-38(39(41-30)44-31-18-8-3-9-19-31)43-46(34-24-14-6-15-25-34,35-26-16-7-17-27-35)29-28-45(42-37,32-20-10-4-11-21-32)33-22-12-5-13-23-33/h3-27,30,36-39H,28-29H2,1-2H3/t30-,36-,37+,38-,39-/m0/s1 |
| InChIKey | NHMZYOHBSOZGDB-QLQJEQSRSA-N |
| XLogP | 5.84 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 660.98 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|