C14H17FN2O2S — CID 113085086
N-[[1-(5-fluoro-1H-indol-3-yl)cyclopropyl]methyl]ethanesulfonamide (PubChem CID 113085086) has the molecular formula C14H17FN2O2S and a molecular weight of 296.37 g/mol. Its IUPAC name is N-[[1-(5-fluoro-1H-indol-3-yl)cyclopropyl]methyl]ethanesulfonamide.
| Compound Name | N-[[1-(5-fluoro-1H-indol-3-yl)cyclopropyl]methyl]ethanesulfonamide |
|---|---|
| PubChem CID | 113085086 |
| Molecular Formula | C14H17FN2O2S |
| Molecular Weight | 296.37 g/mol |
| Exact Mass | 296.10 |
| IUPAC Name | N-[[1-(5-fluoro-1H-indol-3-yl)cyclopropyl]methyl]ethanesulfonamide |
| SMILES | CCS(=O)(=O)NCC1(c2c[nH]c3ccc(F)cc23)CC1 |
| InChI | InChI=1S/C14H17FN2O2S/c1-2-20(18,19)17-9-14(5-6-14)12-8-16-13-4-3-10(15)7-11(12)13/h3-4,7-8,16-17H,2,5-6,9H2,1H3 |
| InChIKey | KKAZZWGXSHYYSL-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 61.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.37 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |