C14H18N2O2S — CID 113086472
3-[(1-methylsulfonylpyrrolidin-2-yl)methyl]-1H-indole (PubChem CID 113086472) has the molecular formula C14H18N2O2S and a molecular weight of 278.38 g/mol. Its IUPAC name is 3-[(1-methylsulfonylpyrrolidin-2-yl)methyl]-1H-indole.
| Compound Name | 3-[(1-methylsulfonylpyrrolidin-2-yl)methyl]-1H-indole |
|---|---|
| PubChem CID | 113086472 |
| Molecular Formula | C14H18N2O2S |
| Molecular Weight | 278.38 g/mol |
| Exact Mass | 278.11 |
| IUPAC Name | 3-[(1-methylsulfonylpyrrolidin-2-yl)methyl]-1H-indole |
| SMILES | CS(=O)(=O)N1CCCC1Cc1c[nH]c2ccccc12 |
| InChI | InChI=1S/C14H18N2O2S/c1-19(17,18)16-8-4-5-12(16)9-11-10-15-14-7-3-2-6-13(11)14/h2-3,6-7,10,12,15H,4-5,8-9H2,1H3 |
| InChIKey | BBNKTNSDSCRWJD-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 53.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.38 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |