C50H68N2O4 — CID 11308721
bis[(1R,9R,10R)-17-(cyclobutylmethyl)-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-trien-4-yl] octanedioate (PubChem CID 11308721) has the molecular formula C50H68N2O4 and a molecular weight of 761.10 g/mol. Its IUPAC name is bis[(1R,9R,10R)-17-(cyclobutylmethyl)-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-trien-4-yl] octanedioate.
| Compound Name | bis[(1R,9R,10R)-17-(cyclobutylmethyl)-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-trien-4-yl] octanedioate |
|---|---|
| PubChem CID | 11308721 |
| Molecular Formula | C50H68N2O4 |
| Molecular Weight | 761.10 g/mol |
| Exact Mass | 760.52 |
| IUPAC Name | bis[(1R,9R,10R)-17-(cyclobutylmethyl)-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-trien-4-yl] octanedioate |
| SMILES | O=C(CCCCCCC(=O)Oc1ccc2c(c1)[C@@]13CCCC[C@H]1[C@@H](C2)N(CC1CCC1)CC3)Oc1ccc2c(c1)[C@@]13CCCC[C@H]1[C@@H](C2)N(CC1CCC1)CC3 |
| InChI | InChI=1S/C50H68N2O4/c53-47(55-39-21-19-37-29-45-41-15-5-7-23-49(41,43(37)31-39)25-27-51(45)33-35-11-9-12-35)17-3-1-2-4-18-48(54)56-40-22-20-38-30-46-42-16-6-8-24-50(42,44(38)32-40)26-28-52(46)34-36-13-10-14-36/h19-22,31-32,35-36,41-42,45-46H,1-18,23-30,33-34H2/t41-,42-,45+,46+,49+,50+/m0/s1 |
| InChIKey | ZLZOQZBMSGPYPY-UBHOSDFBSA-N |
| XLogP | 10.26 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 761.10 |
| LogP ≤ 5 | 10.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|