C21H21BrN2O — CID 113088481
2-(2-bromophenyl)-1-[3-(1-methylindol-2-yl)pyrrolidin-1-yl]ethanone (PubChem CID 113088481) has the molecular formula C21H21BrN2O and a molecular weight of 397.32 g/mol. Its IUPAC name is 2-(2-bromophenyl)-1-[3-(1-methylindol-2-yl)pyrrolidin-1-yl]ethanone.
| Compound Name | 2-(2-bromophenyl)-1-[3-(1-methylindol-2-yl)pyrrolidin-1-yl]ethanone |
|---|---|
| PubChem CID | 113088481 |
| Molecular Formula | C21H21BrN2O |
| Molecular Weight | 397.32 g/mol |
| Exact Mass | 396.08 |
| IUPAC Name | 2-(2-bromophenyl)-1-[3-(1-methylindol-2-yl)pyrrolidin-1-yl]ethanone |
| SMILES | Cn1c(C2CCN(C(=O)Cc3ccccc3Br)C2)cc2ccccc21 |
| InChI | InChI=1S/C21H21BrN2O/c1-23-19-9-5-3-7-16(19)12-20(23)17-10-11-24(14-17)21(25)13-15-6-2-4-8-18(15)22/h2-9,12,17H,10-11,13-14H2,1H3 |
| InChIKey | NXYAPQZRYWMZBM-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 25.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.32 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |