C27H24N4O14S4 — CID 11308915
5-[4-[(1E,3E,5E,7Z)-7-[1-(3,5-disulfophenyl)-3-methyl-5-oxopyrazol-4-ylidene]hepta-1,3,5-trienyl]-3-methyl-5-oxo-4H-pyrazol-1-yl]benzene-1,3-disulfonic acid (PubChem CID 11308915) has the molecular formula C27H24N4O14S4 and a molecular weight of 756.77 g/mol. Its IUPAC name is 5-[4-[(1E,3E,5E,7Z)-7-[1-(3,5-disulfophenyl)-3-methyl-5-oxopyrazol-4-ylidene]hepta-1,3,5-trienyl]-3-methyl-5-oxo-4H-pyrazol-1-yl]benzene-1,3-disulfonic acid.
| Compound Name | 5-[4-[(1E,3E,5E,7Z)-7-[1-(3,5-disulfophenyl)-3-methyl-5-oxopyrazol-4-ylidene]hepta-1,3,5-trienyl]-3-methyl-5-oxo-4H-pyrazol-1-yl]benzene-1,3-disulfonic acid |
|---|---|
| PubChem CID | 11308915 |
| Molecular Formula | C27H24N4O14S4 |
| Molecular Weight | 756.77 g/mol |
| Exact Mass | 756.02 |
| IUPAC Name | 5-[4-[(1E,3E,5E,7Z)-7-[1-(3,5-disulfophenyl)-3-methyl-5-oxopyrazol-4-ylidene]hepta-1,3,5-trienyl]-3-methyl-5-oxo-4H-pyrazol-1-yl]benzene-1,3-disulfonic acid |
| SMILES | CC1=NN(c2cc(S(=O)(=O)O)cc(S(=O)(=O)O)c2)C(=O)/C1=C\C=C\C=C\C=C\C1C(=O)N(c2cc(S(=O)(=O)O)cc(S(=O)(=O)O)c2)N=C1C |
| InChI | InChI=1S/C27H24N4O14S4/c1-16-24(26(32)30(28-16)18-10-20(46(34,35)36)14-21(11-18)47(37,38)39)8-6-4-3-5-7-9-25-17(2)29-31(27(25)33)19-12-22(48(40,41)42)15-23(13-19)49(43,44)45/h3-15,24H,1-2H3,(H,34,35,36)(H,37,38,39)(H,40,41,42)(H,43,44,45)/b4-3+,7-5+,8-6+,25-9- |
| InChIKey | LZGAPHRIEDTULL-KSEIOXSJSA-N |
| XLogP | 2.03 |
| TPSA | 282.82 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 756.77 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'ene_five_het_A(201)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|