C54H44N4O2SZn — CID 11308976
zinc S-[[4-[15-(4-formylphenyl)-10,20-bis(2,4,6-trimethylphenyl)porphyrin-22,24-diid-5-yl]phenyl]methyl] ethanethioate (PubChem CID 11308976) has the molecular formula C54H44N4O2SZn and a molecular weight of 878.43 g/mol. Its IUPAC name is zinc S-[[4-[15-(4-formylphenyl)-10,20-bis(2,4,6-trimethylphenyl)porphyrin-22,24-diid-5-yl]phenyl]methyl] ethanethioate.
| Compound Name | zinc S-[[4-[15-(4-formylphenyl)-10,20-bis(2,4,6-trimethylphenyl)porphyrin-22,24-diid-5-yl]phenyl]methyl] ethanethioate |
|---|---|
| PubChem CID | 11308976 |
| Molecular Formula | C54H44N4O2SZn |
| Molecular Weight | 878.43 g/mol |
| Exact Mass | 876.25 |
| IUPAC Name | zinc S-[[4-[15-(4-formylphenyl)-10,20-bis(2,4,6-trimethylphenyl)porphyrin-22,24-diid-5-yl]phenyl]methyl] ethanethioate |
| SMILES | CC(=O)SCc1ccc(-c2c3nc(c(-c4c(C)cc(C)cc4C)c4ccc([n-]4)c(-c4ccc(C=O)cc4)c4nc(c(-c5c(C)cc(C)cc5C)c5ccc2[n-]5)C=C4)C=C3)cc1.[Zn+2] |
| InChI | InChI=1S/C54H45N4O2S.Zn/c1-30-24-32(3)49(33(4)25-30)53-45-20-16-41(55-45)51(39-12-8-37(28-59)9-13-39)42-17-21-46(56-42)54(50-34(5)26-31(2)27-35(50)6)48-23-19-44(58-48)52(43-18-22-47(53)57-43)40-14-10-38(11-15-40)29-61-36(7)60;/h8-28H,29H2,1-7H3,(H-,55,56,57,58,59);/q-1;+2/p-1/b51-41-,51-42-,52-43-,52-44-,53-45+,53-47+,54-46+,54-48+; |
| InChIKey | IRCXXWYNPHOUQA-SZPXWFBOSA-M |
| XLogP | 13.02 |
| TPSA | 88.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 62 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 878.43 |
| LogP ≤ 5 | 13.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|