About 9-bromophenanthrene
9-bromophenanthrene (PubChem CID 11309) has the molecular formula C14H9Br
and a molecular weight of 257.13 g/mol. Its IUPAC name is 9-bromophenanthrene.
Molecular Properties
| Compound Name | 9-bromophenanthrene |
| PubChem CID | 11309 |
| Molecular Formula | C14H9Br |
| Molecular Weight | 257.13 g/mol |
| Exact Mass | 255.99 |
| IUPAC Name | 9-bromophenanthrene |
| SMILES | Brc1cc2ccccc2c2ccccc12 |
| InChI | InChI=1S/C14H9Br/c15-14-9-10-5-1-2-6-11(10)12-7-3-4-8-13(12)14/h1-9H |
| InChIKey | RSQXKVWKJVUZDG-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 257.13 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|
Analyze 9-bromophenanthrene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9-bromophenanthrene?
The IUPAC name of 9-bromophenanthrene (CID 11309) is 9-bromophenanthrene.
What is the SMILES notation for 9-bromophenanthrene?
The canonical SMILES for 9-bromophenanthrene is Brc1cc2ccccc2c2ccccc12.
What is the InChIKey of 9-bromophenanthrene?
The InChIKey is RSQXKVWKJVUZDG-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H9Br/c15-14-9-10-5-1-2-6-11(10)12-7-3-4-8-13(12)14/h1-9H.
What are the key properties of 9-bromophenanthrene?
9-bromophenanthrene has a molecular weight of 257.13 g/mol, XLogP of 4.76, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 9-bromophenanthrene is sourced from PubChem (CID 11309), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).