About CID 11309108
CID 11309108 (PubChem CID 11309108) has the molecular formula C50H42Br4
and a molecular weight of 962.50 g/mol.
Molecular Properties
| Compound Name | CID 11309108 |
| PubChem CID | 11309108 |
| Molecular Formula | C50H42Br4 |
| Molecular Weight | 962.50 g/mol |
| Exact Mass | 958.00 |
| IUPAC Name | — |
| SMILES | C#Cc1cc(C#Cc2cc(Br)c([C]c3c(C)cc(C(C)(C)C)cc3C)c(Br)c2)cc(C#Cc2cc(Br)c([C]c3c(C)cc(C(C)(C)C)cc3C)c(Br)c2)c1 |
| InChI | InChI=1S/C50H42Br4/c1-12-34-21-35(13-15-37-24-45(51)43(46(52)25-37)28-41-30(2)17-39(18-31(41)3)49(6,7)8)23-36(22-34)14-16-38-26-47(53)44(48(54)27-38)29-42-32(4)19-40(20-33(42)5)50(9,10)11/h1,17-27H,2-11H3 |
| InChIKey | ZQVHTSUEEOSBLJ-UHFFFAOYSA-N |
| XLogP | 14.30 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 54 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 962.50 |
| LogP ≤ 5 | 14.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze CID 11309108 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 11309108?
The IUPAC name of CID 11309108 (CID 11309108) is not available.
What is the SMILES notation for CID 11309108?
The canonical SMILES for CID 11309108 is C#Cc1cc(C#Cc2cc(Br)c([C]c3c(C)cc(C(C)(C)C)cc3C)c(Br)c2)cc(C#Cc2cc(Br)c([C]c3c(C)cc(C(C)(C)C)cc3C)c(Br)c2)c1.
What is the InChIKey of CID 11309108?
The InChIKey is ZQVHTSUEEOSBLJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C50H42Br4/c1-12-34-21-35(13-15-37-24-45(51)43(46(52)25-37)28-41-30(2)17-39(18-31(41)3)49(6,7)8)23-36(22-34)14-16-38-26-47(53)44(48(54)27-38)29-42-32(4)19-40(20-33(42)5)50(9,10)11/h1,17-27H,2-11H3.
What are the key properties of CID 11309108?
CID 11309108 has a molecular weight of 962.50 g/mol, XLogP of 14.30, 4 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for CID 11309108 is sourced from PubChem (CID 11309108), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).