C49H50P2 — CID 11309256
[4'-bis(3,5-dimethylphenyl)phosphanyl-3,3'-spirobi[1,2-dihydroindene]-4-yl]-bis(3,5-dimethylphenyl)phosphane (PubChem CID 11309256) has the molecular formula C49H50P2 and a molecular weight of 700.89 g/mol. Its IUPAC name is [4'-bis(3,5-dimethylphenyl)phosphanyl-3,3'-spirobi[1,2-dihydroindene]-4-yl]-bis(3,5-dimethylphenyl)phosphane.
| Compound Name | [4'-bis(3,5-dimethylphenyl)phosphanyl-3,3'-spirobi[1,2-dihydroindene]-4-yl]-bis(3,5-dimethylphenyl)phosphane |
|---|---|
| PubChem CID | 11309256 |
| Molecular Formula | C49H50P2 |
| Molecular Weight | 700.89 g/mol |
| Exact Mass | 700.34 |
| IUPAC Name | [4'-bis(3,5-dimethylphenyl)phosphanyl-3,3'-spirobi[1,2-dihydroindene]-4-yl]-bis(3,5-dimethylphenyl)phosphane |
| SMILES | Cc1cc(C)cc(P(c2cc(C)cc(C)c2)c2cccc3c2C2(CC3)CCc3cccc(P(c4cc(C)cc(C)c4)c4cc(C)cc(C)c4)c32)c1 |
| InChI | InChI=1S/C49H50P2/c1-31-19-32(2)24-41(23-31)50(42-25-33(3)20-34(4)26-42)45-13-9-11-39-15-17-49(47(39)45)18-16-40-12-10-14-46(48(40)49)51(43-27-35(5)21-36(6)28-43)44-29-37(7)22-38(8)30-44/h9-14,19-30H,15-18H2,1-8H3 |
| InChIKey | AZSBNBQMIMQOPG-UHFFFAOYSA-N |
| XLogP | 9.85 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 700.89 |
| LogP ≤ 5 | 9.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|