C15H21FN2O2 — CID 113092676
N-(5-fluoro-2-morpholin-4-ylphenyl)-2,2-dimethylpropanamide (PubChem CID 113092676) has the molecular formula C15H21FN2O2 and a molecular weight of 280.34 g/mol. Its IUPAC name is N-(5-fluoro-2-morpholin-4-ylphenyl)-2,2-dimethylpropanamide.
| Compound Name | N-(5-fluoro-2-morpholin-4-ylphenyl)-2,2-dimethylpropanamide |
|---|---|
| PubChem CID | 113092676 |
| Molecular Formula | C15H21FN2O2 |
| Molecular Weight | 280.34 g/mol |
| Exact Mass | 280.16 |
| IUPAC Name | N-(5-fluoro-2-morpholin-4-ylphenyl)-2,2-dimethylpropanamide |
| SMILES | CC(C)(C)C(=O)Nc1cc(F)ccc1N1CCOCC1 |
| InChI | InChI=1S/C15H21FN2O2/c1-15(2,3)14(19)17-12-10-11(16)4-5-13(12)18-6-8-20-9-7-18/h4-5,10H,6-9H2,1-3H3,(H,17,19) |
| InChIKey | JVGXGZRLZWHQRV-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.34 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |