C15H17FN2O4S2 — CID 113093138
N-[5-fluoro-2-[methyl(methylsulfonyl)amino]phenyl]-2-methylbenzenesulfonamide (PubChem CID 113093138) has the molecular formula C15H17FN2O4S2 and a molecular weight of 372.44 g/mol. Its IUPAC name is N-[5-fluoro-2-[methyl(methylsulfonyl)amino]phenyl]-2-methylbenzenesulfonamide.
| Compound Name | N-[5-fluoro-2-[methyl(methylsulfonyl)amino]phenyl]-2-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 113093138 |
| Molecular Formula | C15H17FN2O4S2 |
| Molecular Weight | 372.44 g/mol |
| Exact Mass | 372.06 |
| IUPAC Name | N-[5-fluoro-2-[methyl(methylsulfonyl)amino]phenyl]-2-methylbenzenesulfonamide |
| SMILES | Cc1ccccc1S(=O)(=O)Nc1cc(F)ccc1N(C)S(C)(=O)=O |
| InChI | InChI=1S/C15H17FN2O4S2/c1-11-6-4-5-7-15(11)24(21,22)17-13-10-12(16)8-9-14(13)18(2)23(3,19)20/h4-10,17H,1-3H3 |
| InChIKey | YCZWRHJSYBVHHO-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.44 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |