C17H16F2N2O3S — CID 113093216
N-cyclopropyl-N-[4-fluoro-2-[(4-fluorophenyl)sulfonylamino]phenyl]acetamide (PubChem CID 113093216) has the molecular formula C17H16F2N2O3S and a molecular weight of 366.39 g/mol. Its IUPAC name is N-cyclopropyl-N-[4-fluoro-2-[(4-fluorophenyl)sulfonylamino]phenyl]acetamide.
| Compound Name | N-cyclopropyl-N-[4-fluoro-2-[(4-fluorophenyl)sulfonylamino]phenyl]acetamide |
|---|---|
| PubChem CID | 113093216 |
| Molecular Formula | C17H16F2N2O3S |
| Molecular Weight | 366.39 g/mol |
| Exact Mass | 366.08 |
| IUPAC Name | N-cyclopropyl-N-[4-fluoro-2-[(4-fluorophenyl)sulfonylamino]phenyl]acetamide |
| SMILES | CC(=O)N(c1ccc(F)cc1NS(=O)(=O)c1ccc(F)cc1)C1CC1 |
| InChI | InChI=1S/C17H16F2N2O3S/c1-11(22)21(14-5-6-14)17-9-4-13(19)10-16(17)20-25(23,24)15-7-2-12(18)3-8-15/h2-4,7-10,14,20H,5-6H2,1H3 |
| InChIKey | BTFRJVKVFZNIDT-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.39 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |