C9H11FN2O3S — CID 113093308
N-[5-fluoro-2-(methanesulfonamido)phenyl]acetamide (PubChem CID 113093308) has the molecular formula C9H11FN2O3S and a molecular weight of 246.26 g/mol. Its IUPAC name is N-[5-fluoro-2-(methanesulfonamido)phenyl]acetamide.
| Compound Name | N-[5-fluoro-2-(methanesulfonamido)phenyl]acetamide |
|---|---|
| PubChem CID | 113093308 |
| Molecular Formula | C9H11FN2O3S |
| Molecular Weight | 246.26 g/mol |
| Exact Mass | 246.05 |
| IUPAC Name | N-[5-fluoro-2-(methanesulfonamido)phenyl]acetamide |
| SMILES | CC(=O)Nc1cc(F)ccc1NS(C)(=O)=O |
| InChI | InChI=1S/C9H11FN2O3S/c1-6(13)11-9-5-7(10)3-4-8(9)12-16(2,14)15/h3-5,12H,1-2H3,(H,11,13) |
| InChIKey | BMGWWCVGQWYJDO-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.26 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |