C17H20N2O4S2 — CID 113093650
N-[2-[cyclopropyl(methylsulfonyl)amino]phenyl]-3-methylbenzenesulfonamide (PubChem CID 113093650) has the molecular formula C17H20N2O4S2 and a molecular weight of 380.49 g/mol. Its IUPAC name is N-[2-[cyclopropyl(methylsulfonyl)amino]phenyl]-3-methylbenzenesulfonamide.
| Compound Name | N-[2-[cyclopropyl(methylsulfonyl)amino]phenyl]-3-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 113093650 |
| Molecular Formula | C17H20N2O4S2 |
| Molecular Weight | 380.49 g/mol |
| Exact Mass | 380.09 |
| IUPAC Name | N-[2-[cyclopropyl(methylsulfonyl)amino]phenyl]-3-methylbenzenesulfonamide |
| SMILES | Cc1cccc(S(=O)(=O)Nc2ccccc2N(C2CC2)S(C)(=O)=O)c1 |
| InChI | InChI=1S/C17H20N2O4S2/c1-13-6-5-7-15(12-13)25(22,23)18-16-8-3-4-9-17(16)19(14-10-11-14)24(2,20)21/h3-9,12,14,18H,10-11H2,1-2H3 |
| InChIKey | KWEDDCRANMGVCX-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.49 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |