C8H16O — CID 11309518
(3S,4S)-2,4-dimethylhex-5-en-3-ol (PubChem CID 11309518) has the molecular formula C8H16O and a molecular weight of 128.21 g/mol. Its IUPAC name is (3S,4S)-2,4-dimethylhex-5-en-3-ol.
| Compound Name | (3S,4S)-2,4-dimethylhex-5-en-3-ol |
|---|---|
| PubChem CID | 11309518 |
| Molecular Formula | C8H16O |
| Molecular Weight | 128.21 g/mol |
| Exact Mass | 128.12 |
| IUPAC Name | (3S,4S)-2,4-dimethylhex-5-en-3-ol |
| SMILES | C=C[C@H](C)[C@@H](O)C(C)C |
| InChI | InChI=1S/C8H16O/c1-5-7(4)8(9)6(2)3/h5-9H,1H2,2-4H3/t7-,8-/m0/s1 |
| InChIKey | JRWCUTVCSGZAQO-YUMQZZPRSA-N |
| XLogP | 1.83 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 128.21 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|