C21H23NO4S — CID 113095346
N-(2,3,6,7-tetrahydrofuro[2,3-f][1]benzofuran-4-ylmethyl)-5,6,7,8-tetrahydronaphthalene-2-sulfonamide (PubChem CID 113095346) has the molecular formula C21H23NO4S and a molecular weight of 385.49 g/mol. Its IUPAC name is N-(2,3,6,7-tetrahydrofuro[2,3-f][1]benzofuran-4-ylmethyl)-5,6,7,8-tetrahydronaphthalene-2-sulfonamide.
| Compound Name | N-(2,3,6,7-tetrahydrofuro[2,3-f][1]benzofuran-4-ylmethyl)-5,6,7,8-tetrahydronaphthalene-2-sulfonamide |
|---|---|
| PubChem CID | 113095346 |
| Molecular Formula | C21H23NO4S |
| Molecular Weight | 385.49 g/mol |
| Exact Mass | 385.13 |
| IUPAC Name | N-(2,3,6,7-tetrahydrofuro[2,3-f][1]benzofuran-4-ylmethyl)-5,6,7,8-tetrahydronaphthalene-2-sulfonamide |
| SMILES | O=S(=O)(NCc1c2c(cc3c1OCC3)OCC2)c1ccc2c(c1)CCCC2 |
| InChI | InChI=1S/C21H23NO4S/c23-27(24,17-6-5-14-3-1-2-4-15(14)11-17)22-13-19-18-8-10-25-20(18)12-16-7-9-26-21(16)19/h5-6,11-12,22H,1-4,7-10,13H2 |
| InChIKey | FRKCDTPQONTXCK-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.49 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |