About (5R)-non-1-en-6-yn-5-ol
(5R)-non-1-en-6-yn-5-ol (PubChem CID 11309547) has the molecular formula C9H14O
and a molecular weight of 138.21 g/mol. Its IUPAC name is (5R)-non-1-en-6-yn-5-ol.
Molecular Properties
| Compound Name | (5R)-non-1-en-6-yn-5-ol |
| PubChem CID | 11309547 |
| Molecular Formula | C9H14O |
| Molecular Weight | 138.21 g/mol |
| Exact Mass | 138.10 |
| IUPAC Name | (5R)-non-1-en-6-yn-5-ol |
| SMILES | C=CCC[C@@H](O)C#CCC |
| InChI | InChI=1S/C9H14O/c1-3-5-7-9(10)8-6-4-2/h3,9-10H,1,4-5,7H2,2H3/t9-/m1/s1 |
| InChIKey | SKRRQTLPQUQYSL-SECBINFHSA-N |
| XLogP | 1.73 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 138.21 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze (5R)-non-1-en-6-yn-5-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5R)-non-1-en-6-yn-5-ol?
The IUPAC name of (5R)-non-1-en-6-yn-5-ol (CID 11309547) is (5R)-non-1-en-6-yn-5-ol.
What is the SMILES notation for (5R)-non-1-en-6-yn-5-ol?
The canonical SMILES for (5R)-non-1-en-6-yn-5-ol is C=CCC[C@@H](O)C#CCC.
What is the InChIKey of (5R)-non-1-en-6-yn-5-ol?
The InChIKey is SKRRQTLPQUQYSL-SECBINFHSA-N. The full InChI is InChI=1S/C9H14O/c1-3-5-7-9(10)8-6-4-2/h3,9-10H,1,4-5,7H2,2H3/t9-/m1/s1.
What are the key properties of (5R)-non-1-en-6-yn-5-ol?
(5R)-non-1-en-6-yn-5-ol has a molecular weight of 138.21 g/mol, XLogP of 1.73, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (5R)-non-1-en-6-yn-5-ol is sourced from PubChem (CID 11309547), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).