About [(3S,4S,5R)-4-methyl-5-prop-1-en-2-yloxolan-3-yl]methanol
[(3S,4S,5R)-4-methyl-5-prop-1-en-2-yloxolan-3-yl]methanol (PubChem CID 11309641) has the molecular formula C9H16O2
and a molecular weight of 156.22 g/mol. Its IUPAC name is [(3S,4S,5R)-4-methyl-5-prop-1-en-2-yloxolan-3-yl]methanol.
Molecular Properties
| Compound Name | [(3S,4S,5R)-4-methyl-5-prop-1-en-2-yloxolan-3-yl]methanol |
| PubChem CID | 11309641 |
| Molecular Formula | C9H16O2 |
| Molecular Weight | 156.22 g/mol |
| Exact Mass | 156.12 |
| IUPAC Name | [(3S,4S,5R)-4-methyl-5-prop-1-en-2-yloxolan-3-yl]methanol |
| SMILES | C=C(C)[C@@H]1OC[C@H](CO)[C@@H]1C |
| InChI | InChI=1S/C9H16O2/c1-6(2)9-7(3)8(4-10)5-11-9/h7-10H,1,4-5H2,2-3H3/t7-,8-,9-/m0/s1 |
| InChIKey | GVQSYDPGLVBQRA-CIUDSAMLSA-N |
| XLogP | 1.21 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 156.22 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze [(3S,4S,5R)-4-methyl-5-prop-1-en-2-yloxolan-3-yl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(3S,4S,5R)-4-methyl-5-prop-1-en-2-yloxolan-3-yl]methanol?
The IUPAC name of [(3S,4S,5R)-4-methyl-5-prop-1-en-2-yloxolan-3-yl]methanol (CID 11309641) is [(3S,4S,5R)-4-methyl-5-prop-1-en-2-yloxolan-3-yl]methanol.
What is the SMILES notation for [(3S,4S,5R)-4-methyl-5-prop-1-en-2-yloxolan-3-yl]methanol?
The canonical SMILES for [(3S,4S,5R)-4-methyl-5-prop-1-en-2-yloxolan-3-yl]methanol is C=C(C)[C@@H]1OC[C@H](CO)[C@@H]1C.
What is the InChIKey of [(3S,4S,5R)-4-methyl-5-prop-1-en-2-yloxolan-3-yl]methanol?
The InChIKey is GVQSYDPGLVBQRA-CIUDSAMLSA-N. The full InChI is InChI=1S/C9H16O2/c1-6(2)9-7(3)8(4-10)5-11-9/h7-10H,1,4-5H2,2-3H3/t7-,8-,9-/m0/s1.
What are the key properties of [(3S,4S,5R)-4-methyl-5-prop-1-en-2-yloxolan-3-yl]methanol?
[(3S,4S,5R)-4-methyl-5-prop-1-en-2-yloxolan-3-yl]methanol has a molecular weight of 156.22 g/mol, XLogP of 1.21, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [(3S,4S,5R)-4-methyl-5-prop-1-en-2-yloxolan-3-yl]methanol is sourced from PubChem (CID 11309641), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).