C18H20FNO4 — CID 113096429
3-fluoro-N-[2-(2,3,5-trimethoxyphenyl)ethyl]benzamide (PubChem CID 113096429) has the molecular formula C18H20FNO4 and a molecular weight of 333.36 g/mol. Its IUPAC name is 3-fluoro-N-[2-(2,3,5-trimethoxyphenyl)ethyl]benzamide.
| Compound Name | 3-fluoro-N-[2-(2,3,5-trimethoxyphenyl)ethyl]benzamide |
|---|---|
| PubChem CID | 113096429 |
| Molecular Formula | C18H20FNO4 |
| Molecular Weight | 333.36 g/mol |
| Exact Mass | 333.14 |
| IUPAC Name | 3-fluoro-N-[2-(2,3,5-trimethoxyphenyl)ethyl]benzamide |
| SMILES | COc1cc(CCNC(=O)c2cccc(F)c2)c(OC)c(OC)c1 |
| InChI | InChI=1S/C18H20FNO4/c1-22-15-10-12(17(24-3)16(11-15)23-2)7-8-20-18(21)13-5-4-6-14(19)9-13/h4-6,9-11H,7-8H2,1-3H3,(H,20,21) |
| InChIKey | IWIKKAYODLFRLQ-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.36 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |