C20H21N3O2 — CID 113097077
1-(6-methoxy-2,3,4,9-tetrahydro-1H-carbazol-3-yl)-3-phenylurea (PubChem CID 113097077) has the molecular formula C20H21N3O2 and a molecular weight of 335.41 g/mol. Its IUPAC name is 1-(6-methoxy-2,3,4,9-tetrahydro-1H-carbazol-3-yl)-3-phenylurea.
| Compound Name | 1-(6-methoxy-2,3,4,9-tetrahydro-1H-carbazol-3-yl)-3-phenylurea |
|---|---|
| PubChem CID | 113097077 |
| Molecular Formula | C20H21N3O2 |
| Molecular Weight | 335.41 g/mol |
| Exact Mass | 335.16 |
| IUPAC Name | 1-(6-methoxy-2,3,4,9-tetrahydro-1H-carbazol-3-yl)-3-phenylurea |
| SMILES | COc1ccc2[nH]c3c(c2c1)CC(NC(=O)Nc1ccccc1)CC3 |
| InChI | InChI=1S/C20H21N3O2/c1-25-15-8-10-19-17(12-15)16-11-14(7-9-18(16)23-19)22-20(24)21-13-5-3-2-4-6-13/h2-6,8,10,12,14,23H,7,9,11H2,1H3,(H2,21,22,24) |
| InChIKey | LLHXJGQUYOCSSH-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 66.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.41 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|