About (2Z,5Z)-4-but-3-enoxyhepta-2,5-diene
(2Z,5Z)-4-but-3-enoxyhepta-2,5-diene (PubChem CID 11309730) has the molecular formula C11H18O
and a molecular weight of 166.26 g/mol. Its IUPAC name is (2Z,5Z)-4-but-3-enoxyhepta-2,5-diene.
Molecular Properties
| Compound Name | (2Z,5Z)-4-but-3-enoxyhepta-2,5-diene |
| PubChem CID | 11309730 |
| Molecular Formula | C11H18O |
| Molecular Weight | 166.26 g/mol |
| Exact Mass | 166.14 |
| IUPAC Name | (2Z,5Z)-4-but-3-enoxyhepta-2,5-diene |
| SMILES | C=CCCOC(/C=C\C)/C=C\C |
| InChI | InChI=1S/C11H18O/c1-4-7-10-12-11(8-5-2)9-6-3/h4-6,8-9,11H,1,7,10H2,2-3H3/b8-5-,9-6- |
| InChIKey | MEJCUARGNWZSKW-VVRUXRSYSA-N |
| XLogP | 3.10 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 166.26 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (2Z,5Z)-4-but-3-enoxyhepta-2,5-diene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2Z,5Z)-4-but-3-enoxyhepta-2,5-diene?
The IUPAC name of (2Z,5Z)-4-but-3-enoxyhepta-2,5-diene (CID 11309730) is (2Z,5Z)-4-but-3-enoxyhepta-2,5-diene.
What is the SMILES notation for (2Z,5Z)-4-but-3-enoxyhepta-2,5-diene?
The canonical SMILES for (2Z,5Z)-4-but-3-enoxyhepta-2,5-diene is C=CCCOC(/C=C\C)/C=C\C.
What is the InChIKey of (2Z,5Z)-4-but-3-enoxyhepta-2,5-diene?
The InChIKey is MEJCUARGNWZSKW-VVRUXRSYSA-N. The full InChI is InChI=1S/C11H18O/c1-4-7-10-12-11(8-5-2)9-6-3/h4-6,8-9,11H,1,7,10H2,2-3H3/b8-5-,9-6-.
What are the key properties of (2Z,5Z)-4-but-3-enoxyhepta-2,5-diene?
(2Z,5Z)-4-but-3-enoxyhepta-2,5-diene has a molecular weight of 166.26 g/mol, XLogP of 3.10, 6 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (2Z,5Z)-4-but-3-enoxyhepta-2,5-diene is sourced from PubChem (CID 11309730), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).