(2-ethoxy-3-pyridinyl)boronic acid

C7H10BNO3 — CID 11309733

IUPAC(2-ethoxy-3-pyridinyl)boronic acid
SMILESCCOc1ncccc1B(O)O
InChIInChI=1S/C7H10BNO3/c1-2-12-7-6(8(10)11)4-3-5-9-7/h3-5,10-11H,2H2,1H3
InChIKeyFXUMKSCYKPOZOO-UHFFFAOYSA-N
MW166.97 g/mol
LogP-0.84
Rot. Bonds3

About (2-ethoxy-3-pyridinyl)boronic acid

(2-ethoxy-3-pyridinyl)boronic acid (PubChem CID 11309733) has the molecular formula C7H10BNO3 and a molecular weight of 166.97 g/mol. Its IUPAC name is (2-ethoxy-3-pyridinyl)boronic acid.

Molecular Properties

Compound Name(2-ethoxy-3-pyridinyl)boronic acid
PubChem CID11309733
Molecular FormulaC7H10BNO3
Molecular Weight166.97 g/mol
Exact Mass167.08
IUPAC Name(2-ethoxy-3-pyridinyl)boronic acid
SMILESCCOc1ncccc1B(O)O
InChIInChI=1S/C7H10BNO3/c1-2-12-7-6(8(10)11)4-3-5-9-7/h3-5,10-11H,2H2,1H3
InChIKeyFXUMKSCYKPOZOO-UHFFFAOYSA-N
XLogP-0.84
TPSA62.58 Ų
H-Bond Donors2
H-Bond Acceptors4
Rotatable Bonds3
Heavy Atoms12
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500166.97
LogP ≤ 5-0.84
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'heavy_metal', 'substructure': 'N/A'}

Analyze (2-ethoxy-3-pyridinyl)boronic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (2-ethoxy-3-pyridinyl)boronic acid?
The IUPAC name of (2-ethoxy-3-pyridinyl)boronic acid (CID 11309733) is (2-ethoxy-3-pyridinyl)boronic acid.
What is the SMILES notation for (2-ethoxy-3-pyridinyl)boronic acid?
The canonical SMILES for (2-ethoxy-3-pyridinyl)boronic acid is CCOc1ncccc1B(O)O.
What is the InChIKey of (2-ethoxy-3-pyridinyl)boronic acid?
The InChIKey is FXUMKSCYKPOZOO-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H10BNO3/c1-2-12-7-6(8(10)11)4-3-5-9-7/h3-5,10-11H,2H2,1H3.
What are the key properties of (2-ethoxy-3-pyridinyl)boronic acid?
(2-ethoxy-3-pyridinyl)boronic acid has a molecular weight of 166.97 g/mol, XLogP of -0.84, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2-ethoxy-3-pyridinyl)boronic acid is sourced from PubChem (CID 11309733), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).