C17H23N3O5 — CID 113097878
ethyl 2-[[2-[4-(2-methoxyphenyl)piperazin-1-yl]-2-oxoethyl]amino]-2-oxoacetate (PubChem CID 113097878) has the molecular formula C17H23N3O5 and a molecular weight of 349.39 g/mol. Its IUPAC name is ethyl 2-[[2-[4-(2-methoxyphenyl)piperazin-1-yl]-2-oxoethyl]amino]-2-oxoacetate.
| Compound Name | ethyl 2-[[2-[4-(2-methoxyphenyl)piperazin-1-yl]-2-oxoethyl]amino]-2-oxoacetate |
|---|---|
| PubChem CID | 113097878 |
| Molecular Formula | C17H23N3O5 |
| Molecular Weight | 349.39 g/mol |
| Exact Mass | 349.16 |
| IUPAC Name | ethyl 2-[[2-[4-(2-methoxyphenyl)piperazin-1-yl]-2-oxoethyl]amino]-2-oxoacetate |
| SMILES | CCOC(=O)C(=O)NCC(=O)N1CCN(c2ccccc2OC)CC1 |
| InChI | InChI=1S/C17H23N3O5/c1-3-25-17(23)16(22)18-12-15(21)20-10-8-19(9-11-20)13-6-4-5-7-14(13)24-2/h4-7H,3,8-12H2,1-2H3,(H,18,22) |
| InChIKey | LPKNWLHRAMTCNZ-UHFFFAOYSA-N |
| XLogP | 0.02 |
| TPSA | 88.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.39 |
| LogP ≤ 5 | 0.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|