C19H27N3O5 — CID 113097949
tert-butyl 2-[[2-[4-(4-methoxyphenyl)piperazin-1-yl]-2-oxoethyl]amino]-2-oxoacetate (PubChem CID 113097949) has the molecular formula C19H27N3O5 and a molecular weight of 377.44 g/mol. Its IUPAC name is tert-butyl 2-[[2-[4-(4-methoxyphenyl)piperazin-1-yl]-2-oxoethyl]amino]-2-oxoacetate.
| Compound Name | tert-butyl 2-[[2-[4-(4-methoxyphenyl)piperazin-1-yl]-2-oxoethyl]amino]-2-oxoacetate |
|---|---|
| PubChem CID | 113097949 |
| Molecular Formula | C19H27N3O5 |
| Molecular Weight | 377.44 g/mol |
| Exact Mass | 377.20 |
| IUPAC Name | tert-butyl 2-[[2-[4-(4-methoxyphenyl)piperazin-1-yl]-2-oxoethyl]amino]-2-oxoacetate |
| SMILES | COc1ccc(N2CCN(C(=O)CNC(=O)C(=O)OC(C)(C)C)CC2)cc1 |
| InChI | InChI=1S/C19H27N3O5/c1-19(2,3)27-18(25)17(24)20-13-16(23)22-11-9-21(10-12-22)14-5-7-15(26-4)8-6-14/h5-8H,9-13H2,1-4H3,(H,20,24) |
| InChIKey | GOBBTOIXPYXOFN-UHFFFAOYSA-N |
| XLogP | 0.80 |
| TPSA | 88.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.44 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|