C7H14OS2 — CID 11309862
(Z)-1,2-bis(methylsulfanyl)pent-1-en-3-ol (PubChem CID 11309862) has the molecular formula C7H14OS2 and a molecular weight of 178.32 g/mol. Its IUPAC name is (Z)-1,2-bis(methylsulfanyl)pent-1-en-3-ol.
| Compound Name | (Z)-1,2-bis(methylsulfanyl)pent-1-en-3-ol |
|---|---|
| PubChem CID | 11309862 |
| Molecular Formula | C7H14OS2 |
| Molecular Weight | 178.32 g/mol |
| Exact Mass | 178.05 |
| IUPAC Name | (Z)-1,2-bis(methylsulfanyl)pent-1-en-3-ol |
| SMILES | CCC(O)/C(=C/SC)SC |
| InChI | InChI=1S/C7H14OS2/c1-4-6(8)7(10-3)5-9-2/h5-6,8H,4H2,1-3H3/b7-5- |
| InChIKey | RQRWSGRUSJXRJY-ALCCZGGFSA-N |
| XLogP | 2.32 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.32 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |