C17H16BrNO — CID 113098893
2-(3-bromophenyl)-1-(2-methyl-2,3-dihydroindol-1-yl)ethanone (PubChem CID 113098893) has the molecular formula C17H16BrNO and a molecular weight of 330.23 g/mol. Its IUPAC name is 2-(3-bromophenyl)-1-(2-methyl-2,3-dihydroindol-1-yl)ethanone.
| Compound Name | 2-(3-bromophenyl)-1-(2-methyl-2,3-dihydroindol-1-yl)ethanone |
|---|---|
| PubChem CID | 113098893 |
| Molecular Formula | C17H16BrNO |
| Molecular Weight | 330.23 g/mol |
| Exact Mass | 329.04 |
| IUPAC Name | 2-(3-bromophenyl)-1-(2-methyl-2,3-dihydroindol-1-yl)ethanone |
| SMILES | CC1Cc2ccccc2N1C(=O)Cc1cccc(Br)c1 |
| InChI | InChI=1S/C17H16BrNO/c1-12-9-14-6-2-3-8-16(14)19(12)17(20)11-13-5-4-7-15(18)10-13/h2-8,10,12H,9,11H2,1H3 |
| InChIKey | IOBYFDMCHQMZKE-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.23 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |