About 4,4-difluorobutoxybenzene
4,4-difluorobutoxybenzene (PubChem CID 11309941) has the molecular formula C10H12F2O
and a molecular weight of 186.20 g/mol. Its IUPAC name is 4,4-difluorobutoxybenzene.
Molecular Properties
| Compound Name | 4,4-difluorobutoxybenzene |
| PubChem CID | 11309941 |
| Molecular Formula | C10H12F2O |
| Molecular Weight | 186.20 g/mol |
| Exact Mass | 186.09 |
| IUPAC Name | 4,4-difluorobutoxybenzene |
| SMILES | FC(F)CCCOc1ccccc1 |
| InChI | InChI=1S/C10H12F2O/c11-10(12)7-4-8-13-9-5-2-1-3-6-9/h1-3,5-6,10H,4,7-8H2 |
| InChIKey | UEABTCMEMBCYGO-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 186.20 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 4,4-difluorobutoxybenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,4-difluorobutoxybenzene?
The IUPAC name of 4,4-difluorobutoxybenzene (CID 11309941) is 4,4-difluorobutoxybenzene.
What is the SMILES notation for 4,4-difluorobutoxybenzene?
The canonical SMILES for 4,4-difluorobutoxybenzene is FC(F)CCCOc1ccccc1.
What is the InChIKey of 4,4-difluorobutoxybenzene?
The InChIKey is UEABTCMEMBCYGO-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12F2O/c11-10(12)7-4-8-13-9-5-2-1-3-6-9/h1-3,5-6,10H,4,7-8H2.
What are the key properties of 4,4-difluorobutoxybenzene?
4,4-difluorobutoxybenzene has a molecular weight of 186.20 g/mol, XLogP of 3.11, 5 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4,4-difluorobutoxybenzene is sourced from PubChem (CID 11309941), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).