C9H14O4 — CID 11309942
(2R,3R,6S)-2-(hydroxymethyl)-6-prop-2-enoxy-3,6-dihydro-2H-pyran-3-ol (PubChem CID 11309942) has the molecular formula C9H14O4 and a molecular weight of 186.21 g/mol. Its IUPAC name is (2R,3R,6S)-2-(hydroxymethyl)-6-prop-2-enoxy-3,6-dihydro-2H-pyran-3-ol.
| Compound Name | (2R,3R,6S)-2-(hydroxymethyl)-6-prop-2-enoxy-3,6-dihydro-2H-pyran-3-ol |
|---|---|
| PubChem CID | 11309942 |
| Molecular Formula | C9H14O4 |
| Molecular Weight | 186.21 g/mol |
| Exact Mass | 186.09 |
| IUPAC Name | (2R,3R,6S)-2-(hydroxymethyl)-6-prop-2-enoxy-3,6-dihydro-2H-pyran-3-ol |
| SMILES | C=CCO[C@@H]1C=C[C@@H](O)[C@@H](CO)O1 |
| InChI | InChI=1S/C9H14O4/c1-2-5-12-9-4-3-7(11)8(6-10)13-9/h2-4,7-11H,1,5-6H2/t7-,8-,9+/m1/s1 |
| InChIKey | HCQVQZXOQQJSQT-HLTSFMKQSA-N |
| XLogP | -0.18 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.21 |
| LogP ≤ 5 | -0.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|