C11H13NO2 — CID 11310032
(4S,5S)-5-benzyl-4-hydroxypyrrolidin-2-one (PubChem CID 11310032) has the molecular formula C11H13NO2 and a molecular weight of 191.23 g/mol. Its IUPAC name is (4S,5S)-5-benzyl-4-hydroxypyrrolidin-2-one.
| Compound Name | (4S,5S)-5-benzyl-4-hydroxypyrrolidin-2-one |
|---|---|
| PubChem CID | 11310032 |
| Molecular Formula | C11H13NO2 |
| Molecular Weight | 191.23 g/mol |
| Exact Mass | 191.09 |
| IUPAC Name | (4S,5S)-5-benzyl-4-hydroxypyrrolidin-2-one |
| SMILES | O=C1C[C@H](O)[C@H](Cc2ccccc2)N1 |
| InChI | InChI=1S/C11H13NO2/c13-10-7-11(14)12-9(10)6-8-4-2-1-3-5-8/h1-5,9-10,13H,6-7H2,(H,12,14)/t9-,10-/m0/s1 |
| InChIKey | AFEUCARVKFDANA-UWVGGRQHSA-N |
| XLogP | 0.48 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.23 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |