C12H22O2 — CID 11310134
(4S,5R)-4,5-dimethoxy-4,5-dimethylocta-1,7-diene (PubChem CID 11310134) has the molecular formula C12H22O2 and a molecular weight of 198.31 g/mol. Its IUPAC name is (4S,5R)-4,5-dimethoxy-4,5-dimethylocta-1,7-diene.
| Compound Name | (4S,5R)-4,5-dimethoxy-4,5-dimethylocta-1,7-diene |
|---|---|
| PubChem CID | 11310134 |
| Molecular Formula | C12H22O2 |
| Molecular Weight | 198.31 g/mol |
| Exact Mass | 198.16 |
| IUPAC Name | (4S,5R)-4,5-dimethoxy-4,5-dimethylocta-1,7-diene |
| SMILES | C=CC[C@@](C)(OC)[C@](C)(CC=C)OC |
| InChI | InChI=1S/C12H22O2/c1-7-9-11(3,13-5)12(4,14-6)10-8-2/h7-8H,1-2,9-10H2,3-6H3/t11-,12+ |
| InChIKey | QIXYNCKWCWUYKK-TXEJJXNPSA-N |
| XLogP | 2.95 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.31 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|