About [(6S)-2,6-dimethylcyclohexen-1-yl]oxy-trimethylsilane
[(6S)-2,6-dimethylcyclohexen-1-yl]oxy-trimethylsilane (PubChem CID 11310139) has the molecular formula C11H22OSi
and a molecular weight of 198.38 g/mol. Its IUPAC name is [(6S)-2,6-dimethylcyclohexen-1-yl]oxy-trimethylsilane.
Molecular Properties
| Compound Name | [(6S)-2,6-dimethylcyclohexen-1-yl]oxy-trimethylsilane |
| PubChem CID | 11310139 |
| Molecular Formula | C11H22OSi |
| Molecular Weight | 198.38 g/mol |
| Exact Mass | 198.14 |
| IUPAC Name | [(6S)-2,6-dimethylcyclohexen-1-yl]oxy-trimethylsilane |
| SMILES | CC1=C(O[Si](C)(C)C)[C@@H](C)CCC1 |
| InChI | InChI=1S/C11H22OSi/c1-9-7-6-8-10(2)11(9)12-13(3,4)5/h9H,6-8H2,1-5H3/t9-/m0/s1 |
| InChIKey | ZDXAHOGJVIYMLD-VIFPVBQESA-N |
| XLogP | 3.93 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 198.38 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze [(6S)-2,6-dimethylcyclohexen-1-yl]oxy-trimethylsilane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(6S)-2,6-dimethylcyclohexen-1-yl]oxy-trimethylsilane?
The IUPAC name of [(6S)-2,6-dimethylcyclohexen-1-yl]oxy-trimethylsilane (CID 11310139) is [(6S)-2,6-dimethylcyclohexen-1-yl]oxy-trimethylsilane.
What is the SMILES notation for [(6S)-2,6-dimethylcyclohexen-1-yl]oxy-trimethylsilane?
The canonical SMILES for [(6S)-2,6-dimethylcyclohexen-1-yl]oxy-trimethylsilane is CC1=C(O[Si](C)(C)C)[C@@H](C)CCC1.
What is the InChIKey of [(6S)-2,6-dimethylcyclohexen-1-yl]oxy-trimethylsilane?
The InChIKey is ZDXAHOGJVIYMLD-VIFPVBQESA-N. The full InChI is InChI=1S/C11H22OSi/c1-9-7-6-8-10(2)11(9)12-13(3,4)5/h9H,6-8H2,1-5H3/t9-/m0/s1.
What are the key properties of [(6S)-2,6-dimethylcyclohexen-1-yl]oxy-trimethylsilane?
[(6S)-2,6-dimethylcyclohexen-1-yl]oxy-trimethylsilane has a molecular weight of 198.38 g/mol, XLogP of 3.93, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for [(6S)-2,6-dimethylcyclohexen-1-yl]oxy-trimethylsilane is sourced from PubChem (CID 11310139), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).