C19H21F2NO4 — CID 113102492
N-[2-(3,4-difluorophenoxy)ethyl]-3-(3,4-dimethoxyphenyl)propanamide (PubChem CID 113102492) has the molecular formula C19H21F2NO4 and a molecular weight of 365.38 g/mol. Its IUPAC name is N-[2-(3,4-difluorophenoxy)ethyl]-3-(3,4-dimethoxyphenyl)propanamide.
| Compound Name | N-[2-(3,4-difluorophenoxy)ethyl]-3-(3,4-dimethoxyphenyl)propanamide |
|---|---|
| PubChem CID | 113102492 |
| Molecular Formula | C19H21F2NO4 |
| Molecular Weight | 365.38 g/mol |
| Exact Mass | 365.14 |
| IUPAC Name | N-[2-(3,4-difluorophenoxy)ethyl]-3-(3,4-dimethoxyphenyl)propanamide |
| SMILES | COc1ccc(CCC(=O)NCCOc2ccc(F)c(F)c2)cc1OC |
| InChI | InChI=1S/C19H21F2NO4/c1-24-17-7-3-13(11-18(17)25-2)4-8-19(23)22-9-10-26-14-5-6-15(20)16(21)12-14/h3,5-7,11-12H,4,8-10H2,1-2H3,(H,22,23) |
| InChIKey | SDUATLBOFQYMMV-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.38 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|