C18H19ClFNO2 — CID 113103060
N-[2-(4-chloro-3,5-dimethylphenoxy)ethyl]-2-(4-fluorophenyl)acetamide (PubChem CID 113103060) has the molecular formula C18H19ClFNO2 and a molecular weight of 335.81 g/mol. Its IUPAC name is N-[2-(4-chloro-3,5-dimethylphenoxy)ethyl]-2-(4-fluorophenyl)acetamide.
| Compound Name | N-[2-(4-chloro-3,5-dimethylphenoxy)ethyl]-2-(4-fluorophenyl)acetamide |
|---|---|
| PubChem CID | 113103060 |
| Molecular Formula | C18H19ClFNO2 |
| Molecular Weight | 335.81 g/mol |
| Exact Mass | 335.11 |
| IUPAC Name | N-[2-(4-chloro-3,5-dimethylphenoxy)ethyl]-2-(4-fluorophenyl)acetamide |
| SMILES | Cc1cc(OCCNC(=O)Cc2ccc(F)cc2)cc(C)c1Cl |
| InChI | InChI=1S/C18H19ClFNO2/c1-12-9-16(10-13(2)18(12)19)23-8-7-21-17(22)11-14-3-5-15(20)6-4-14/h3-6,9-10H,7-8,11H2,1-2H3,(H,21,22) |
| InChIKey | QJGOXZYWPHUMFA-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.81 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|