C12H18O3 — CID 11310340
3-[2-(1,3-dioxan-2-yl)ethyl]cyclohex-2-en-1-one (PubChem CID 11310340) has the molecular formula C12H18O3 and a molecular weight of 210.27 g/mol. Its IUPAC name is 3-[2-(1,3-dioxan-2-yl)ethyl]cyclohex-2-en-1-one.
| Compound Name | 3-[2-(1,3-dioxan-2-yl)ethyl]cyclohex-2-en-1-one |
|---|---|
| PubChem CID | 11310340 |
| Molecular Formula | C12H18O3 |
| Molecular Weight | 210.27 g/mol |
| Exact Mass | 210.13 |
| IUPAC Name | 3-[2-(1,3-dioxan-2-yl)ethyl]cyclohex-2-en-1-one |
| SMILES | O=C1C=C(CCC2OCCCO2)CCC1 |
| InChI | InChI=1S/C12H18O3/c13-11-4-1-3-10(9-11)5-6-12-14-7-2-8-15-12/h9,12H,1-8H2 |
| InChIKey | MTGLDOJTRBOBSW-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.27 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |