C14H16N2 — CID 11310393
7-methyl-3-(1,2,3,6-tetrahydropyridin-4-yl)-1H-indole (PubChem CID 11310393) has the molecular formula C14H16N2 and a molecular weight of 212.30 g/mol. Its IUPAC name is 7-methyl-3-(1,2,3,6-tetrahydropyridin-4-yl)-1H-indole.
| Compound Name | 7-methyl-3-(1,2,3,6-tetrahydropyridin-4-yl)-1H-indole |
|---|---|
| PubChem CID | 11310393 |
| Molecular Formula | C14H16N2 |
| Molecular Weight | 212.30 g/mol |
| Exact Mass | 212.13 |
| IUPAC Name | 7-methyl-3-(1,2,3,6-tetrahydropyridin-4-yl)-1H-indole |
| SMILES | Cc1cccc2c(C3=CCNCC3)c[nH]c12 |
| InChI | InChI=1S/C14H16N2/c1-10-3-2-4-12-13(9-16-14(10)12)11-5-7-15-8-6-11/h2-5,9,15-16H,6-8H2,1H3 |
| InChIKey | QVHVZVRAGSJGIQ-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 27.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.30 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |