C15H18O — CID 11310430
(2R,4Z,6Z,8R)-8-[(E)-pent-2-en-4-ynyl]-2-[(E)-prop-1-enyl]-3,8-dihydro-2H-oxocine (PubChem CID 11310430) has the molecular formula C15H18O and a molecular weight of 214.31 g/mol. Its IUPAC name is (2R,4Z,6Z,8R)-8-[(E)-pent-2-en-4-ynyl]-2-[(E)-prop-1-enyl]-3,8-dihydro-2H-oxocine.
| Compound Name | (2R,4Z,6Z,8R)-8-[(E)-pent-2-en-4-ynyl]-2-[(E)-prop-1-enyl]-3,8-dihydro-2H-oxocine |
|---|---|
| PubChem CID | 11310430 |
| Molecular Formula | C15H18O |
| Molecular Weight | 214.31 g/mol |
| Exact Mass | 214.14 |
| IUPAC Name | (2R,4Z,6Z,8R)-8-[(E)-pent-2-en-4-ynyl]-2-[(E)-prop-1-enyl]-3,8-dihydro-2H-oxocine |
| SMILES | C#C/C=C/C[C@@H]1/C=C\C=C/C[C@H](/C=C/C)O1 |
| InChI | InChI=1S/C15H18O/c1-3-5-7-11-15-13-9-6-8-12-14(16-15)10-4-2/h1,4-10,13-15H,11-12H2,2H3/b7-5+,8-6-,10-4+,13-9-/t14-,15+/m0/s1 |
| InChIKey | FMXQCXMGCMAHEE-KFEHBTHVSA-N |
| XLogP | 3.41 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.31 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|