C14H18O2 — CID 11310526
(5aS,10Z,11aS)-3,4,5a,6,7,8,9,11a-octahydro-2H-cycloocta[b][1]benzofuran-1-one (PubChem CID 11310526) has the molecular formula C14H18O2 and a molecular weight of 218.30 g/mol. Its IUPAC name is (5aS,10Z,11aS)-3,4,5a,6,7,8,9,11a-octahydro-2H-cycloocta[b][1]benzofuran-1-one.
| Compound Name | (5aS,10Z,11aS)-3,4,5a,6,7,8,9,11a-octahydro-2H-cycloocta[b][1]benzofuran-1-one |
|---|---|
| PubChem CID | 11310526 |
| Molecular Formula | C14H18O2 |
| Molecular Weight | 218.30 g/mol |
| Exact Mass | 218.13 |
| IUPAC Name | (5aS,10Z,11aS)-3,4,5a,6,7,8,9,11a-octahydro-2H-cycloocta[b][1]benzofuran-1-one |
| SMILES | O=C1CCCC2=C1[C@@H]1/C=C\CCCC[C@@H]1O2 |
| InChI | InChI=1S/C14H18O2/c15-11-7-5-9-13-14(11)10-6-3-1-2-4-8-12(10)16-13/h3,6,10,12H,1-2,4-5,7-9H2/b6-3-/t10-,12+/m1/s1 |
| InChIKey | VRCSQBJJQOUFPA-UAJXTSGYSA-N |
| XLogP | 3.14 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.30 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|