C17H28N4O2 — CID 113105658
4-[2-(dimethylamino)ethyl]-N-[(4-methoxyphenyl)methyl]piperazine-1-carboxamide (PubChem CID 113105658) has the molecular formula C17H28N4O2 and a molecular weight of 320.44 g/mol. Its IUPAC name is 4-[2-(dimethylamino)ethyl]-N-[(4-methoxyphenyl)methyl]piperazine-1-carboxamide.
| Compound Name | 4-[2-(dimethylamino)ethyl]-N-[(4-methoxyphenyl)methyl]piperazine-1-carboxamide |
|---|---|
| PubChem CID | 113105658 |
| Molecular Formula | C17H28N4O2 |
| Molecular Weight | 320.44 g/mol |
| Exact Mass | 320.22 |
| IUPAC Name | 4-[2-(dimethylamino)ethyl]-N-[(4-methoxyphenyl)methyl]piperazine-1-carboxamide |
| SMILES | COc1ccc(CNC(=O)N2CCN(CCN(C)C)CC2)cc1 |
| InChI | InChI=1S/C17H28N4O2/c1-19(2)8-9-20-10-12-21(13-11-20)17(22)18-14-15-4-6-16(23-3)7-5-15/h4-7H,8-14H2,1-3H3,(H,18,22) |
| InChIKey | FOXRVZWQYCWVNO-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 48.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.44 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |