C12H16O4 — CID 11310642
methyl 4,4,6,6-tetramethyl-3,5-dioxocyclohexene-1-carboxylate (PubChem CID 11310642) has the molecular formula C12H16O4 and a molecular weight of 224.26 g/mol. Its IUPAC name is methyl 4,4,6,6-tetramethyl-3,5-dioxocyclohexene-1-carboxylate.
| Compound Name | methyl 4,4,6,6-tetramethyl-3,5-dioxocyclohexene-1-carboxylate |
|---|---|
| PubChem CID | 11310642 |
| Molecular Formula | C12H16O4 |
| Molecular Weight | 224.26 g/mol |
| Exact Mass | 224.10 |
| IUPAC Name | methyl 4,4,6,6-tetramethyl-3,5-dioxocyclohexene-1-carboxylate |
| SMILES | COC(=O)C1=CC(=O)C(C)(C)C(=O)C1(C)C |
| InChI | InChI=1S/C12H16O4/c1-11(2)7(9(14)16-5)6-8(13)12(3,4)10(11)15/h6H,1-5H3 |
| InChIKey | YEULPJJLOMFNDE-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.26 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|