About 2-ethynyl-3-iodopyridine
2-ethynyl-3-iodopyridine (PubChem CID 11310749) has the molecular formula C7H4IN
and a molecular weight of 229.02 g/mol. Its IUPAC name is 2-ethynyl-3-iodopyridine.
Molecular Properties
| Compound Name | 2-ethynyl-3-iodopyridine |
| PubChem CID | 11310749 |
| Molecular Formula | C7H4IN |
| Molecular Weight | 229.02 g/mol |
| Exact Mass | 228.94 |
| IUPAC Name | 2-ethynyl-3-iodopyridine |
| SMILES | C#Cc1ncccc1I |
| InChI | InChI=1S/C7H4IN/c1-2-7-6(8)4-3-5-9-7/h1,3-5H |
| InChIKey | HGRLZUZGSQIRGZ-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 229.02 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-ethynyl-3-iodopyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethynyl-3-iodopyridine?
The IUPAC name of 2-ethynyl-3-iodopyridine (CID 11310749) is 2-ethynyl-3-iodopyridine.
What is the SMILES notation for 2-ethynyl-3-iodopyridine?
The canonical SMILES for 2-ethynyl-3-iodopyridine is C#Cc1ncccc1I.
What is the InChIKey of 2-ethynyl-3-iodopyridine?
The InChIKey is HGRLZUZGSQIRGZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H4IN/c1-2-7-6(8)4-3-5-9-7/h1,3-5H.
What are the key properties of 2-ethynyl-3-iodopyridine?
2-ethynyl-3-iodopyridine has a molecular weight of 229.02 g/mol, XLogP of 1.67, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethynyl-3-iodopyridine is sourced from PubChem (CID 11310749), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).