C20H22ClN3O3 — CID 113107902
methyl 2-[[4-[(4-chlorophenyl)methyl]piperazine-1-carbonyl]amino]benzoate (PubChem CID 113107902) has the molecular formula C20H22ClN3O3 and a molecular weight of 387.87 g/mol. Its IUPAC name is methyl 2-[[4-[(4-chlorophenyl)methyl]piperazine-1-carbonyl]amino]benzoate.
| Compound Name | methyl 2-[[4-[(4-chlorophenyl)methyl]piperazine-1-carbonyl]amino]benzoate |
|---|---|
| PubChem CID | 113107902 |
| Molecular Formula | C20H22ClN3O3 |
| Molecular Weight | 387.87 g/mol |
| Exact Mass | 387.13 |
| IUPAC Name | methyl 2-[[4-[(4-chlorophenyl)methyl]piperazine-1-carbonyl]amino]benzoate |
| SMILES | COC(=O)c1ccccc1NC(=O)N1CCN(Cc2ccc(Cl)cc2)CC1 |
| InChI | InChI=1S/C20H22ClN3O3/c1-27-19(25)17-4-2-3-5-18(17)22-20(26)24-12-10-23(11-13-24)14-15-6-8-16(21)9-7-15/h2-9H,10-14H2,1H3,(H,22,26) |
| InChIKey | ZUXYRYBCFYHFOC-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.87 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |