C11H18ClNO2 — CID 11310807
1-[(2R,3S,3aS)-2-(3-chloropropyl)-2,3,3a,4,5,6-hexahydropyrrolo[1,2-b][1,2]oxazol-3-yl]ethanone (PubChem CID 11310807) has the molecular formula C11H18ClNO2 and a molecular weight of 231.72 g/mol. Its IUPAC name is 1-[(2R,3S,3aS)-2-(3-chloropropyl)-2,3,3a,4,5,6-hexahydropyrrolo[1,2-b][1,2]oxazol-3-yl]ethanone.
| Compound Name | 1-[(2R,3S,3aS)-2-(3-chloropropyl)-2,3,3a,4,5,6-hexahydropyrrolo[1,2-b][1,2]oxazol-3-yl]ethanone |
|---|---|
| PubChem CID | 11310807 |
| Molecular Formula | C11H18ClNO2 |
| Molecular Weight | 231.72 g/mol |
| Exact Mass | 231.10 |
| IUPAC Name | 1-[(2R,3S,3aS)-2-(3-chloropropyl)-2,3,3a,4,5,6-hexahydropyrrolo[1,2-b][1,2]oxazol-3-yl]ethanone |
| SMILES | CC(=O)[C@@H]1[C@@H](CCCCl)ON2CCC[C@@H]12 |
| InChI | InChI=1S/C11H18ClNO2/c1-8(14)11-9-4-3-7-13(9)15-10(11)5-2-6-12/h9-11H,2-7H2,1H3/t9-,10+,11-/m0/s1 |
| InChIKey | ZSKRRAZCXDYZPN-AXFHLTTASA-N |
| XLogP | 1.99 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.72 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|