C21H25N5O — CID 113108556
4-[2-(1H-indol-3-yl)ethyl]-N-(pyridin-3-ylmethyl)piperazine-1-carboxamide (PubChem CID 113108556) has the molecular formula C21H25N5O and a molecular weight of 363.47 g/mol. Its IUPAC name is 4-[2-(1H-indol-3-yl)ethyl]-N-(pyridin-3-ylmethyl)piperazine-1-carboxamide.
| Compound Name | 4-[2-(1H-indol-3-yl)ethyl]-N-(pyridin-3-ylmethyl)piperazine-1-carboxamide |
|---|---|
| PubChem CID | 113108556 |
| Molecular Formula | C21H25N5O |
| Molecular Weight | 363.47 g/mol |
| Exact Mass | 363.21 |
| IUPAC Name | 4-[2-(1H-indol-3-yl)ethyl]-N-(pyridin-3-ylmethyl)piperazine-1-carboxamide |
| SMILES | O=C(NCc1cccnc1)N1CCN(CCc2c[nH]c3ccccc23)CC1 |
| InChI | InChI=1S/C21H25N5O/c27-21(24-15-17-4-3-8-22-14-17)26-12-10-25(11-13-26)9-7-18-16-23-20-6-2-1-5-19(18)20/h1-6,8,14,16,23H,7,9-13,15H2,(H,24,27) |
| InChIKey | GGDWLTMENPWFLC-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 64.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.47 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |