C10H21NO5 — CID 11310892
(1S,2R,3R,4S)-6-(2-hydroxyethylamino)cyclooctane-1,2,3,4-tetrol (PubChem CID 11310892) has the molecular formula C10H21NO5 and a molecular weight of 235.28 g/mol. Its IUPAC name is (1S,2R,3R,4S)-6-(2-hydroxyethylamino)cyclooctane-1,2,3,4-tetrol.
| Compound Name | (1S,2R,3R,4S)-6-(2-hydroxyethylamino)cyclooctane-1,2,3,4-tetrol |
|---|---|
| PubChem CID | 11310892 |
| Molecular Formula | C10H21NO5 |
| Molecular Weight | 235.28 g/mol |
| Exact Mass | 235.14 |
| IUPAC Name | (1S,2R,3R,4S)-6-(2-hydroxyethylamino)cyclooctane-1,2,3,4-tetrol |
| SMILES | OCCNC1CC[C@H](O)[C@@H](O)[C@H](O)[C@@H](O)C1 |
| InChI | InChI=1S/C10H21NO5/c12-4-3-11-6-1-2-7(13)9(15)10(16)8(14)5-6/h6-16H,1-5H2/t6?,7-,8-,9+,10+/m0/s1 |
| InChIKey | LBKPDORJHDRGBZ-XNMJNOLGSA-N |
| XLogP | -2.44 |
| TPSA | 113.18 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.28 |
| LogP ≤ 5 | -2.44 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |