About 5-iodopyrimidine-4,6-diamine
5-iodopyrimidine-4,6-diamine (PubChem CID 11310900) has the molecular formula C4H5IN4
and a molecular weight of 236.02 g/mol. Its IUPAC name is 5-iodopyrimidine-4,6-diamine.
Molecular Properties
| Compound Name | 5-iodopyrimidine-4,6-diamine |
| PubChem CID | 11310900 |
| Molecular Formula | C4H5IN4 |
| Molecular Weight | 236.02 g/mol |
| Exact Mass | 235.96 |
| IUPAC Name | 5-iodopyrimidine-4,6-diamine |
| SMILES | Nc1ncnc(N)c1I |
| InChI | InChI=1S/C4H5IN4/c5-2-3(6)8-1-9-4(2)7/h1H,(H4,6,7,8,9) |
| InChIKey | DGHLQCSKEMTMIS-UHFFFAOYSA-N |
| XLogP | 0.25 |
| TPSA | 77.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 236.02 |
| LogP ≤ 5 | 0.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 5-iodopyrimidine-4,6-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-iodopyrimidine-4,6-diamine?
The IUPAC name of 5-iodopyrimidine-4,6-diamine (CID 11310900) is 5-iodopyrimidine-4,6-diamine.
What is the SMILES notation for 5-iodopyrimidine-4,6-diamine?
The canonical SMILES for 5-iodopyrimidine-4,6-diamine is Nc1ncnc(N)c1I.
What is the InChIKey of 5-iodopyrimidine-4,6-diamine?
The InChIKey is DGHLQCSKEMTMIS-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H5IN4/c5-2-3(6)8-1-9-4(2)7/h1H,(H4,6,7,8,9).
What are the key properties of 5-iodopyrimidine-4,6-diamine?
5-iodopyrimidine-4,6-diamine has a molecular weight of 236.02 g/mol, XLogP of 0.25, 0 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-iodopyrimidine-4,6-diamine is sourced from PubChem (CID 11310900), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).