C21H26ClN3O — CID 113109947
N-[2-(4-chlorophenyl)ethyl]-4-(3,4-dimethylphenyl)piperazine-1-carboxamide (PubChem CID 113109947) has the molecular formula C21H26ClN3O and a molecular weight of 371.91 g/mol. Its IUPAC name is N-[2-(4-chlorophenyl)ethyl]-4-(3,4-dimethylphenyl)piperazine-1-carboxamide.
| Compound Name | N-[2-(4-chlorophenyl)ethyl]-4-(3,4-dimethylphenyl)piperazine-1-carboxamide |
|---|---|
| PubChem CID | 113109947 |
| Molecular Formula | C21H26ClN3O |
| Molecular Weight | 371.91 g/mol |
| Exact Mass | 371.18 |
| IUPAC Name | N-[2-(4-chlorophenyl)ethyl]-4-(3,4-dimethylphenyl)piperazine-1-carboxamide |
| SMILES | Cc1ccc(N2CCN(C(=O)NCCc3ccc(Cl)cc3)CC2)cc1C |
| InChI | InChI=1S/C21H26ClN3O/c1-16-3-8-20(15-17(16)2)24-11-13-25(14-12-24)21(26)23-10-9-18-4-6-19(22)7-5-18/h3-8,15H,9-14H2,1-2H3,(H,23,26) |
| InChIKey | MXAJHLPXZNWEHQ-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.91 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|