C18H29N3O — CID 113110710
4-(2,5-dimethylphenyl)-N-(3-methylbutyl)piperazine-1-carboxamide (PubChem CID 113110710) has the molecular formula C18H29N3O and a molecular weight of 303.45 g/mol. Its IUPAC name is 4-(2,5-dimethylphenyl)-N-(3-methylbutyl)piperazine-1-carboxamide.
| Compound Name | 4-(2,5-dimethylphenyl)-N-(3-methylbutyl)piperazine-1-carboxamide |
|---|---|
| PubChem CID | 113110710 |
| Molecular Formula | C18H29N3O |
| Molecular Weight | 303.45 g/mol |
| Exact Mass | 303.23 |
| IUPAC Name | 4-(2,5-dimethylphenyl)-N-(3-methylbutyl)piperazine-1-carboxamide |
| SMILES | Cc1ccc(C)c(N2CCN(C(=O)NCCC(C)C)CC2)c1 |
| InChI | InChI=1S/C18H29N3O/c1-14(2)7-8-19-18(22)21-11-9-20(10-12-21)17-13-15(3)5-6-16(17)4/h5-6,13-14H,7-12H2,1-4H3,(H,19,22) |
| InChIKey | DQYXHFLQBBDPPX-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.45 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |