C18H28ClN3O — CID 113110807
N-(2-chloro-4,6-dimethylphenyl)-4-pentylpiperazine-1-carboxamide (PubChem CID 113110807) has the molecular formula C18H28ClN3O and a molecular weight of 337.90 g/mol. Its IUPAC name is N-(2-chloro-4,6-dimethylphenyl)-4-pentylpiperazine-1-carboxamide.
| Compound Name | N-(2-chloro-4,6-dimethylphenyl)-4-pentylpiperazine-1-carboxamide |
|---|---|
| PubChem CID | 113110807 |
| Molecular Formula | C18H28ClN3O |
| Molecular Weight | 337.90 g/mol |
| Exact Mass | 337.19 |
| IUPAC Name | N-(2-chloro-4,6-dimethylphenyl)-4-pentylpiperazine-1-carboxamide |
| SMILES | CCCCCN1CCN(C(=O)Nc2c(C)cc(C)cc2Cl)CC1 |
| InChI | InChI=1S/C18H28ClN3O/c1-4-5-6-7-21-8-10-22(11-9-21)18(23)20-17-15(3)12-14(2)13-16(17)19/h12-13H,4-11H2,1-3H3,(H,20,23) |
| InChIKey | DEUCDGSDSLCTKL-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.90 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|